C12H20Cl2N2O — CID 117045727
3-(1-methylpiperidin-4-yl)oxyaniline;dihydrochloride (PubChem CID 117045727) has the molecular formula C12H20Cl2N2O and a molecular weight of 279.21 g/mol. Its IUPAC name is 3-(1-methylpiperidin-4-yl)oxyaniline;dihydrochloride.
| Compound Name | 3-(1-methylpiperidin-4-yl)oxyaniline;dihydrochloride |
|---|---|
| PubChem CID | 117045727 |
| Molecular Formula | C12H20Cl2N2O |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 3-(1-methylpiperidin-4-yl)oxyaniline;dihydrochloride |
| SMILES | CN1CCC(Oc2cccc(N)c2)CC1.Cl.Cl |
| InChI | InChI=1S/C12H18N2O.2ClH/c1-14-7-5-11(6-8-14)15-12-4-2-3-10(13)9-12;;/h2-4,9,11H,5-8,13H2,1H3;2*1H |
| InChIKey | CSMZODKAPBBQBF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|