C35H38BNO4 — CID 171965145
9H-fluoren-9-ylmethyl 3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 171965145) has the molecular formula C35H38BNO4 and a molecular weight of 547.50 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 171965145 |
| Molecular Formula | C35H38BNO4 |
| Molecular Weight | 547.50 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 3-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | CC1(C)OB(c2cccc(CC3=CC4CCC(C3)N4C(=O)OCC3c4ccccc4-c4ccccc43)c2)OC1(C)C |
| InChI | InChI=1S/C35H38BNO4/c1-34(2)35(3,4)41-36(40-34)25-11-9-10-23(19-25)18-24-20-26-16-17-27(21-24)37(26)33(38)39-22-32-30-14-7-5-12-28(30)29-13-6-8-15-31(29)32/h5-15,19-20,26-27,32H,16-18,21-22H2,1-4H3 |
| InChIKey | LPYNDASVHQFDFW-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.50 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|