C36H40BNO4 — CID 171965134
9H-fluoren-9-ylmethyl 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171965134) has the molecular formula C36H40BNO4 and a molecular weight of 561.53 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171965134 |
| Molecular Formula | C36H40BNO4 |
| Molecular Weight | 561.53 g/mol |
| Exact Mass | 561.31 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | CC1(C)OB(c2ccc(CC3=CC4CCCC(C3)N4C(=O)OCC3c4ccccc4-c4ccccc43)cc2)OC1(C)C |
| InChI | InChI=1S/C36H40BNO4/c1-35(2)36(3,4)42-37(41-35)26-18-16-24(17-19-26)20-25-21-27-10-9-11-28(22-25)38(27)34(39)40-23-33-31-14-7-5-12-29(31)30-13-6-8-15-32(30)33/h5-8,12-19,21,27-28,33H,9-11,20,22-23H2,1-4H3 |
| InChIKey | WQLGPRONBCCCCC-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.53 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|