C31H28F3NO2 — CID 171965459
9H-fluoren-9-ylmethyl 3-[[3-(trifluoromethyl)phenyl]methyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171965459) has the molecular formula C31H28F3NO2 and a molecular weight of 503.56 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 3-[[3-(trifluoromethyl)phenyl]methyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 3-[[3-(trifluoromethyl)phenyl]methyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171965459 |
| Molecular Formula | C31H28F3NO2 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 3-[[3-(trifluoromethyl)phenyl]methyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | O=C(OCC1c2ccccc2-c2ccccc21)N1C2C=C(Cc3cccc(C(F)(F)F)c3)CC1CCC2 |
| InChI | InChI=1S/C31H28F3NO2/c32-31(33,34)22-8-5-7-20(16-22)15-21-17-23-9-6-10-24(18-21)35(23)30(36)37-19-29-27-13-3-1-11-25(27)26-12-2-4-14-28(26)29/h1-5,7-8,11-14,16-17,23-24,29H,6,9-10,15,18-19H2 |
| InChIKey | LQXLSAVAOSQRGF-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|