C22H29N — CID 171972624
8-benzyl-3-oct-2-ynyl-8-azabicyclo[3.2.1]oct-2-ene (PubChem CID 171972624) has the molecular formula C22H29N and a molecular weight of 307.48 g/mol. Its IUPAC name is 8-benzyl-3-oct-2-ynyl-8-azabicyclo[3.2.1]oct-2-ene.
| Compound Name | 8-benzyl-3-oct-2-ynyl-8-azabicyclo[3.2.1]oct-2-ene |
|---|---|
| PubChem CID | 171972624 |
| Molecular Formula | C22H29N |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 8-benzyl-3-oct-2-ynyl-8-azabicyclo[3.2.1]oct-2-ene |
| SMILES | CCCCCC#CCC1=CC2CCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C22H29N/c1-2-3-4-5-6-8-13-20-16-21-14-15-22(17-20)23(21)18-19-11-9-7-10-12-19/h7,9-12,16,21-22H,2-5,13-15,17-18H2,1H3 |
| InChIKey | ZRMMOZUBOXLVDR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|