C23H29NO2 — CID 171970272
benzyl 3-oct-2-ynyl-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 171970272) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is benzyl 3-oct-2-ynyl-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | benzyl 3-oct-2-ynyl-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 171970272 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | benzyl 3-oct-2-ynyl-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | CCCCCC#CCC1=CC2CCC(C1)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H29NO2/c1-2-3-4-5-6-8-13-20-16-21-14-15-22(17-20)24(21)23(25)26-18-19-11-9-7-10-12-19/h7,9-12,16,21-22H,2-5,13-15,17-18H2,1H3 |
| InChIKey | NWPDHONHSWSKNP-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|