C20H25NO3 — CID 171971456
benzyl 3-[(3-methyloxetan-3-yl)methyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 171971456) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is benzyl 3-[(3-methyloxetan-3-yl)methyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | benzyl 3-[(3-methyloxetan-3-yl)methyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 171971456 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | benzyl 3-[(3-methyloxetan-3-yl)methyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | CC1(CC2=CC3CCC(C2)N3C(=O)OCc2ccccc2)COC1 |
| InChI | InChI=1S/C20H25NO3/c1-20(13-23-14-20)11-16-9-17-7-8-18(10-16)21(17)19(22)24-12-15-5-3-2-4-6-15/h2-6,9,17-18H,7-8,10-14H2,1H3 |
| InChIKey | LPCPAXCSLKYVIP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|