C19H23NO2 — CID 171973516
benzyl 3-but-2-en-2-yl-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 171973516) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is benzyl 3-but-2-en-2-yl-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | benzyl 3-but-2-en-2-yl-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 171973516 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | benzyl 3-but-2-en-2-yl-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | CC=C(C)C1=CC2CCC(C1)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H23NO2/c1-3-14(2)16-11-17-9-10-18(12-16)20(17)19(21)22-13-15-7-5-4-6-8-15/h3-8,11,17-18H,9-10,12-13H2,1-2H3 |
| InChIKey | SBQQTQACBHIMBB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |