C21H21NO3S — CID 171969548
benzyl 3-(5-acetylthiophen-2-yl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 171969548) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is benzyl 3-(5-acetylthiophen-2-yl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | benzyl 3-(5-acetylthiophen-2-yl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 171969548 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | benzyl 3-(5-acetylthiophen-2-yl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | CC(=O)c1ccc(C2=CC3CCC(C2)N3C(=O)OCc2ccccc2)s1 |
| InChI | InChI=1S/C21H21NO3S/c1-14(23)19-9-10-20(26-19)16-11-17-7-8-18(12-16)22(17)21(24)25-13-15-5-3-2-4-6-15/h2-6,9-11,17-18H,7-8,12-13H2,1H3 |
| InChIKey | DFNRPJNHOUYEHM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |