C20H21NO2S — CID 171971587
benzyl 3-(5-methylthiophen-2-yl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 171971587) has the molecular formula C20H21NO2S and a molecular weight of 339.46 g/mol. Its IUPAC name is benzyl 3-(5-methylthiophen-2-yl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | benzyl 3-(5-methylthiophen-2-yl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 171971587 |
| Molecular Formula | C20H21NO2S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | benzyl 3-(5-methylthiophen-2-yl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | Cc1ccc(C2=CC3CCC(C2)N3C(=O)OCc2ccccc2)s1 |
| InChI | InChI=1S/C20H21NO2S/c1-14-7-10-19(24-14)16-11-17-8-9-18(12-16)21(17)20(22)23-13-15-5-3-2-4-6-15/h2-7,10-11,17-18H,8-9,12-13H2,1H3 |
| InChIKey | GXQMJCFPZTTYDD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |