C21H27NO2 — CID 171972193
benzyl 3-(3-methylbut-2-en-2-yl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171972193) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is benzyl 3-(3-methylbut-2-en-2-yl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | benzyl 3-(3-methylbut-2-en-2-yl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171972193 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | benzyl 3-(3-methylbut-2-en-2-yl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | CC(C)=C(C)C1=CC2CCCC(C1)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H27NO2/c1-15(2)16(3)18-12-19-10-7-11-20(13-18)22(19)21(23)24-14-17-8-5-4-6-9-17/h4-6,8-9,12,19-20H,7,10-11,13-14H2,1-3H3 |
| InChIKey | LEGOTVPLDPEOFL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |