C20H28N2O2 — CID 171972294
benzyl 3-[2-(dimethylamino)ethyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171972294) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is benzyl 3-[2-(dimethylamino)ethyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | benzyl 3-[2-(dimethylamino)ethyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171972294 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | benzyl 3-[2-(dimethylamino)ethyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | CN(C)CCC1=CC2CCCC(C1)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H28N2O2/c1-21(2)12-11-17-13-18-9-6-10-19(14-17)22(18)20(23)24-15-16-7-4-3-5-8-16/h3-5,7-8,13,18-19H,6,9-12,14-15H2,1-2H3 |
| InChIKey | IOOYTZCFMPVJBT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|