C23H24FNO3 — CID 171968108
benzyl 3-[(3-fluoro-5-methoxyphenyl)methyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 171968108) has the molecular formula C23H24FNO3 and a molecular weight of 381.45 g/mol. Its IUPAC name is benzyl 3-[(3-fluoro-5-methoxyphenyl)methyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | benzyl 3-[(3-fluoro-5-methoxyphenyl)methyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 171968108 |
| Molecular Formula | C23H24FNO3 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | benzyl 3-[(3-fluoro-5-methoxyphenyl)methyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | COc1cc(F)cc(CC2=CC3CCC(C2)N3C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H24FNO3/c1-27-22-13-17(10-19(24)14-22)9-18-11-20-7-8-21(12-18)25(20)23(26)28-15-16-5-3-2-4-6-16/h2-6,10-11,13-14,20-21H,7-9,12,15H2,1H3 |
| InChIKey | CNVUNVSKMUTIOG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|