C24H27NO5 — CID 171967447
benzyl 7-[(3,5-dimethoxyphenyl)methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate (PubChem CID 171967447) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is benzyl 7-[(3,5-dimethoxyphenyl)methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate.
| Compound Name | benzyl 7-[(3,5-dimethoxyphenyl)methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
|---|---|
| PubChem CID | 171967447 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | benzyl 7-[(3,5-dimethoxyphenyl)methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
| SMILES | COc1cc(CC2=CC3COCC(C2)N3C(=O)OCc2ccccc2)cc(OC)c1 |
| InChI | InChI=1S/C24H27NO5/c1-27-22-11-19(12-23(13-22)28-2)8-18-9-20-15-29-16-21(10-18)25(20)24(26)30-14-17-6-4-3-5-7-17/h3-7,9,11-13,20-21H,8,10,14-16H2,1-2H3 |
| InChIKey | MXJIZXPUSKSOMD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|