C22H23NO4 — CID 171969295
benzyl 7-(4-methoxyphenyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate (PubChem CID 171969295) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is benzyl 7-(4-methoxyphenyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate.
| Compound Name | benzyl 7-(4-methoxyphenyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
|---|---|
| PubChem CID | 171969295 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | benzyl 7-(4-methoxyphenyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
| SMILES | COc1ccc(C2=CC3COCC(C2)N3C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H23NO4/c1-25-21-9-7-17(8-10-21)18-11-19-14-26-15-20(12-18)23(19)22(24)27-13-16-5-3-2-4-6-16/h2-11,19-20H,12-15H2,1H3 |
| InChIKey | RLSJBJBBFGWYOJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |