C22H24N2O3 — CID 171969374
benzyl 7-[4-(aminomethyl)phenyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate (PubChem CID 171969374) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is benzyl 7-[4-(aminomethyl)phenyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate.
| Compound Name | benzyl 7-[4-(aminomethyl)phenyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
|---|---|
| PubChem CID | 171969374 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | benzyl 7-[4-(aminomethyl)phenyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
| SMILES | NCc1ccc(C2=CC3COCC(C2)N3C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H24N2O3/c23-12-16-6-8-18(9-7-16)19-10-20-14-26-15-21(11-19)24(20)22(25)27-13-17-4-2-1-3-5-17/h1-10,20-21H,11-15,23H2 |
| InChIKey | IIRURRQSRPPRMV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |