C25H29NO3 — CID 171967880
benzyl 7-(3-tert-butylphenyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate (PubChem CID 171967880) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is benzyl 7-(3-tert-butylphenyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate.
| Compound Name | benzyl 7-(3-tert-butylphenyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
|---|---|
| PubChem CID | 171967880 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | benzyl 7-(3-tert-butylphenyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
| SMILES | CC(C)(C)c1cccc(C2=CC3COCC(C2)N3C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C25H29NO3/c1-25(2,3)21-11-7-10-19(12-21)20-13-22-16-28-17-23(14-20)26(22)24(27)29-15-18-8-5-4-6-9-18/h4-13,22-23H,14-17H2,1-3H3 |
| InChIKey | BTFQBSLCFZAKAL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |