C22H22FNO3 — CID 171968988
benzyl 7-(4-fluoro-3-methylphenyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate (PubChem CID 171968988) has the molecular formula C22H22FNO3 and a molecular weight of 367.42 g/mol. Its IUPAC name is benzyl 7-(4-fluoro-3-methylphenyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate.
| Compound Name | benzyl 7-(4-fluoro-3-methylphenyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
|---|---|
| PubChem CID | 171968988 |
| Molecular Formula | C22H22FNO3 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | benzyl 7-(4-fluoro-3-methylphenyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
| SMILES | Cc1cc(C2=CC3COCC(C2)N3C(=O)OCc2ccccc2)ccc1F |
| InChI | InChI=1S/C22H22FNO3/c1-15-9-17(7-8-21(15)23)18-10-19-13-26-14-20(11-18)24(19)22(25)27-12-16-5-3-2-4-6-16/h2-10,19-20H,11-14H2,1H3 |
| InChIKey | XZNAIYXWZDDHAF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |