C23H23NO3 — CID 171969068
benzyl 7-(4-ethenylphenyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate (PubChem CID 171969068) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is benzyl 7-(4-ethenylphenyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate.
| Compound Name | benzyl 7-(4-ethenylphenyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
|---|---|
| PubChem CID | 171969068 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | benzyl 7-(4-ethenylphenyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
| SMILES | C=Cc1ccc(C2=CC3COCC(C2)N3C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H23NO3/c1-2-17-8-10-19(11-9-17)20-12-21-15-26-16-22(13-20)24(21)23(25)27-14-18-6-4-3-5-7-18/h2-12,21-22H,1,13-16H2 |
| InChIKey | ZSOABQFJFQLHDD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |