C25H28FNO4 — CID 171940882
benzyl 3-[2-(3-fluoro-5-methoxyphenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171940882) has the molecular formula C25H28FNO4 and a molecular weight of 425.50 g/mol. Its IUPAC name is benzyl 3-[2-(3-fluoro-5-methoxyphenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | benzyl 3-[2-(3-fluoro-5-methoxyphenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171940882 |
| Molecular Formula | C25H28FNO4 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | benzyl 3-[2-(3-fluoro-5-methoxyphenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | COc1cc(F)cc(CC(=O)C2CC3CCCC(C2)N3C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C25H28FNO4/c1-30-23-11-18(10-20(26)15-23)12-24(28)19-13-21-8-5-9-22(14-19)27(21)25(29)31-16-17-6-3-2-4-7-17/h2-4,6-7,10-11,15,19,21-22H,5,8-9,12-14,16H2,1H3 |
| InChIKey | VDFPYRVGACLKEA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |