C25H28FNO3 — CID 171948052
benzyl 3-[2-(3-fluoro-4-methylphenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171948052) has the molecular formula C25H28FNO3 and a molecular weight of 409.50 g/mol. Its IUPAC name is benzyl 3-[2-(3-fluoro-4-methylphenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | benzyl 3-[2-(3-fluoro-4-methylphenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171948052 |
| Molecular Formula | C25H28FNO3 |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | benzyl 3-[2-(3-fluoro-4-methylphenyl)acetyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | Cc1ccc(CC(=O)C2CC3CCCC(C2)N3C(=O)OCc2ccccc2)cc1F |
| InChI | InChI=1S/C25H28FNO3/c1-17-10-11-19(12-23(17)26)13-24(28)20-14-21-8-5-9-22(15-20)27(21)25(29)30-16-18-6-3-2-4-7-18/h2-4,6-7,10-12,20-22H,5,8-9,13-16H2,1H3 |
| InChIKey | VEQOFYINQQRVCX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |