C30H31NO4 — CID 171939428
benzyl 3-[2-(3-phenylmethoxyphenyl)acetyl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171939428) has the molecular formula C30H31NO4 and a molecular weight of 469.58 g/mol. Its IUPAC name is benzyl 3-[2-(3-phenylmethoxyphenyl)acetyl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | benzyl 3-[2-(3-phenylmethoxyphenyl)acetyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171939428 |
| Molecular Formula | C30H31NO4 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | benzyl 3-[2-(3-phenylmethoxyphenyl)acetyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | O=C(Cc1cccc(OCc2ccccc2)c1)C1CC2CCC(C1)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H31NO4/c32-29(17-24-12-7-13-28(16-24)34-20-22-8-3-1-4-9-22)25-18-26-14-15-27(19-25)31(26)30(33)35-21-23-10-5-2-6-11-23/h1-13,16,25-27H,14-15,17-21H2 |
| InChIKey | UWBXJCMDDHSTRE-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |