C22H24O2S — CID 171939431
2-(3-phenylmethoxyphenyl)-1-(8-thiabicyclo[3.2.1]octan-3-yl)ethanone (PubChem CID 171939431) has the molecular formula C22H24O2S and a molecular weight of 352.50 g/mol. Its IUPAC name is 2-(3-phenylmethoxyphenyl)-1-(8-thiabicyclo[3.2.1]octan-3-yl)ethanone.
| Compound Name | 2-(3-phenylmethoxyphenyl)-1-(8-thiabicyclo[3.2.1]octan-3-yl)ethanone |
|---|---|
| PubChem CID | 171939431 |
| Molecular Formula | C22H24O2S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-(3-phenylmethoxyphenyl)-1-(8-thiabicyclo[3.2.1]octan-3-yl)ethanone |
| SMILES | O=C(Cc1cccc(OCc2ccccc2)c1)C1CC2CCC(C1)S2 |
| InChI | InChI=1S/C22H24O2S/c23-22(18-13-20-9-10-21(14-18)25-20)12-17-7-4-8-19(11-17)24-15-16-5-2-1-3-6-16/h1-8,11,18,20-21H,9-10,12-15H2 |
| InChIKey | PFAIBGQZYIBLST-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |