C21H22O3S — CID 171939107
(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)-(3-phenylmethoxyphenyl)methanone (PubChem CID 171939107) has the molecular formula C21H22O3S and a molecular weight of 354.47 g/mol. Its IUPAC name is (8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)-(3-phenylmethoxyphenyl)methanone.
| Compound Name | (8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)-(3-phenylmethoxyphenyl)methanone |
|---|---|
| PubChem CID | 171939107 |
| Molecular Formula | C21H22O3S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | (8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)-(3-phenylmethoxyphenyl)methanone |
| SMILES | O=C(c1cccc(OCc2ccccc2)c1)C1CC2CCC(C1)S2=O |
| InChI | InChI=1S/C21H22O3S/c22-21(17-12-19-9-10-20(13-17)25(19)23)16-7-4-8-18(11-16)24-14-15-5-2-1-3-6-15/h1-8,11,17,19-20H,9-10,12-14H2 |
| InChIKey | VTWZACPSGSXQRS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |