C22H21F2NO2 — CID 171969233
benzyl 3-[(2,6-difluorophenyl)methyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 171969233) has the molecular formula C22H21F2NO2 and a molecular weight of 369.41 g/mol. Its IUPAC name is benzyl 3-[(2,6-difluorophenyl)methyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | benzyl 3-[(2,6-difluorophenyl)methyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 171969233 |
| Molecular Formula | C22H21F2NO2 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | benzyl 3-[(2,6-difluorophenyl)methyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C2C=C(Cc3c(F)cccc3F)CC1CC2 |
| InChI | InChI=1S/C22H21F2NO2/c23-20-7-4-8-21(24)19(20)13-16-11-17-9-10-18(12-16)25(17)22(26)27-14-15-5-2-1-3-6-15/h1-8,11,17-18H,9-10,12-14H2 |
| InChIKey | QPSFSPWDCVPWME-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|