C20H30N2 — CID 171973631
2-(8-benzyl-8-azabicyclo[3.2.1]oct-2-en-3-yl)-N,N-diethylethanamine (PubChem CID 171973631) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is 2-(8-benzyl-8-azabicyclo[3.2.1]oct-2-en-3-yl)-N,N-diethylethanamine.
| Compound Name | 2-(8-benzyl-8-azabicyclo[3.2.1]oct-2-en-3-yl)-N,N-diethylethanamine |
|---|---|
| PubChem CID | 171973631 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 2-(8-benzyl-8-azabicyclo[3.2.1]oct-2-en-3-yl)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCC1=CC2CCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C20H30N2/c1-3-21(4-2)13-12-18-14-19-10-11-20(15-18)22(19)16-17-8-6-5-7-9-17/h5-9,14,19-20H,3-4,10-13,15-16H2,1-2H3 |
| InChIKey | XVTYUEKHKILSCV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|