C26H26NP — CID 71613587
[(1R,5S)-3-benzyl-8-azabicyclo[3.2.1]oct-2-en-8-yl]-diphenylphosphane (PubChem CID 71613587) has the molecular formula C26H26NP and a molecular weight of 383.48 g/mol. Its IUPAC name is [(1R,5S)-3-benzyl-8-azabicyclo[3.2.1]oct-2-en-8-yl]-diphenylphosphane.
| Compound Name | [(1R,5S)-3-benzyl-8-azabicyclo[3.2.1]oct-2-en-8-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 71613587 |
| Molecular Formula | C26H26NP |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | [(1R,5S)-3-benzyl-8-azabicyclo[3.2.1]oct-2-en-8-yl]-diphenylphosphane |
| SMILES | C1=C(Cc2ccccc2)C[C@@H]2CC[C@H]1N2P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H26NP/c1-4-10-21(11-5-1)18-22-19-23-16-17-24(20-22)27(23)28(25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-15,19,23-24H,16-18,20H2/t23-,24+/m1/s1 |
| InChIKey | JYMMXLRKOCURBZ-RPWUZVMVSA-N |
| XLogP | 5.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|