C23H30BNO2 — CID 144748134
3,3-dimethyl-1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2H-indole (PubChem CID 144748134) has the molecular formula C23H30BNO2 and a molecular weight of 363.31 g/mol. Its IUPAC name is 3,3-dimethyl-1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2H-indole.
| Compound Name | 3,3-dimethyl-1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2H-indole |
|---|---|
| PubChem CID | 144748134 |
| Molecular Formula | C23H30BNO2 |
| Molecular Weight | 363.31 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 3,3-dimethyl-1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2H-indole |
| SMILES | CC1(C)CN(Cc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)c2ccccc21 |
| InChI | InChI=1S/C23H30BNO2/c1-21(2)16-25(20-10-8-7-9-19(20)21)15-17-11-13-18(14-12-17)24-26-22(3,4)23(5,6)27-24/h7-14H,15-16H2,1-6H3 |
| InChIKey | BPCPIVYKWZESKP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|