C17H27BN2O3 — CID 143915957
4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)-3-pyridinyl]methyl]morpholine (PubChem CID 143915957) has the molecular formula C17H27BN2O3 and a molecular weight of 318.23 g/mol. Its IUPAC name is 4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)-3-pyridinyl]methyl]morpholine.
| Compound Name | 4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)-3-pyridinyl]methyl]morpholine |
|---|---|
| PubChem CID | 143915957 |
| Molecular Formula | C17H27BN2O3 |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)-3-pyridinyl]methyl]morpholine |
| SMILES | CC1(C)COB(c2cncc(CN3CCOCC3)c2)OC1(C)C |
| InChI | InChI=1S/C17H27BN2O3/c1-16(2)13-22-18(23-17(16,3)4)15-9-14(10-19-11-15)12-20-5-7-21-8-6-20/h9-11H,5-8,12-13H2,1-4H3 |
| InChIKey | LECUMCYUBWEDIC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|