C24H33BN2O4 — CID 68937950
tert-butyl N-[1-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]phenyl]ethyl]carbamate (PubChem CID 68937950) has the molecular formula C24H33BN2O4 and a molecular weight of 424.35 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 68937950 |
| Molecular Formula | C24H33BN2O4 |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | tert-butyl N-[1-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]phenyl]ethyl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)c1ccc(-c2cncc(B3OC(C)(C)C(C)(C)O3)c2)cc1 |
| InChI | InChI=1S/C24H33BN2O4/c1-16(27-21(28)29-22(2,3)4)17-9-11-18(12-10-17)19-13-20(15-26-14-19)25-30-23(5,6)24(7,8)31-25/h9-16H,1-8H3,(H,27,28) |
| InChIKey | VASUSJUQBFJHFI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|