C23H27F2NO5S — CID 174270589
ethyl (3S)-3-[2-fluoro-5-(5-fluoro-2-hydroxyphenyl)-3-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoate (PubChem CID 174270589) has the molecular formula C23H27F2NO5S and a molecular weight of 467.53 g/mol. Its IUPAC name is ethyl (3S)-3-[2-fluoro-5-(5-fluoro-2-hydroxyphenyl)-3-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoate.
| Compound Name | ethyl (3S)-3-[2-fluoro-5-(5-fluoro-2-hydroxyphenyl)-3-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 174270589 |
| Molecular Formula | C23H27F2NO5S |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | ethyl (3S)-3-[2-fluoro-5-(5-fluoro-2-hydroxyphenyl)-3-methylphenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoate |
| SMILES | CCOC(=O)C[C@@](S)(NC(=O)OC(C)(C)C)c1cc(-c2cc(F)ccc2O)cc(C)c1F |
| InChI | InChI=1S/C23H27F2NO5S/c1-6-30-19(28)12-23(32,26-21(29)31-22(3,4)5)17-10-14(9-13(2)20(17)25)16-11-15(24)7-8-18(16)27/h7-11,27,32H,6,12H2,1-5H3,(H,26,29)/t23-/m0/s1 |
| InChIKey | VKOLIUKBJFBELA-QHCPKHFHSA-N |
| XLogP | 5.21 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|