C23H35BFNO5S — CID 156728699
ethyl (3S)-3-(tert-butylsulfinylmethylideneamino)-3-[2-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate (PubChem CID 156728699) has the molecular formula C23H35BFNO5S and a molecular weight of 467.41 g/mol. Its IUPAC name is ethyl (3S)-3-(tert-butylsulfinylmethylideneamino)-3-[2-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate.
| Compound Name | ethyl (3S)-3-(tert-butylsulfinylmethylideneamino)-3-[2-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 156728699 |
| Molecular Formula | C23H35BFNO5S |
| Molecular Weight | 467.41 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | ethyl (3S)-3-(tert-butylsulfinylmethylideneamino)-3-[2-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanoate |
| SMILES | CCOC(=O)C[C@H](/N=C/S(=O)C(C)(C)C)c1cc(B2OC(C)(C)C(C)(C)O2)cc(C)c1F |
| InChI | InChI=1S/C23H35BFNO5S/c1-10-29-19(27)13-18(26-14-32(28)21(3,4)5)17-12-16(11-15(2)20(17)25)24-30-22(6,7)23(8,9)31-24/h11-12,14,18H,10,13H2,1-9H3/b26-14+/t18-,32?/m0/s1 |
| InChIKey | YUMJOXZQEXJVID-BHBUAEPISA-N |
| XLogP | 4.00 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|