C19H26BClO6 — CID 172553120
[(2S)-4-ethoxy-4-oxobutan-2-yl] 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 172553120) has the molecular formula C19H26BClO6 and a molecular weight of 396.68 g/mol. Its IUPAC name is [(2S)-4-ethoxy-4-oxobutan-2-yl] 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | [(2S)-4-ethoxy-4-oxobutan-2-yl] 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 172553120 |
| Molecular Formula | C19H26BClO6 |
| Molecular Weight | 396.68 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | [(2S)-4-ethoxy-4-oxobutan-2-yl] 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | CCOC(=O)C[C@H](C)OC(=O)c1cc(B2OC(C)(C)C(C)(C)O2)ccc1Cl |
| InChI | InChI=1S/C19H26BClO6/c1-7-24-16(22)10-12(2)25-17(23)14-11-13(8-9-15(14)21)20-26-18(3,4)19(5,6)27-20/h8-9,11-12H,7,10H2,1-6H3/t12-/m0/s1 |
| InChIKey | WTMVVECOLILCDJ-LBPRGKRZSA-N |
| XLogP | 3.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.68 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|