C22H35BFNO5S — CID 175753337
tert-butyl-[[(1S)-3-ethoxy-1-[2-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-oxopropyl]amino]-oxidosulfanium (PubChem CID 175753337) has the molecular formula C22H35BFNO5S and a molecular weight of 455.40 g/mol. Its IUPAC name is tert-butyl-[[(1S)-3-ethoxy-1-[2-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-oxopropyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(1S)-3-ethoxy-1-[2-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-oxopropyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175753337 |
| Molecular Formula | C22H35BFNO5S |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | tert-butyl-[[(1S)-3-ethoxy-1-[2-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-oxopropyl]amino]-oxidosulfanium |
| SMILES | CCOC(=O)C[C@H](N[S+]([O-])C(C)(C)C)c1cc(B2OC(C)(C)C(C)(C)O2)cc(C)c1F |
| InChI | InChI=1S/C22H35BFNO5S/c1-10-28-18(26)13-17(25-31(27)20(3,4)5)16-12-15(11-14(2)19(16)24)23-29-21(6,7)22(8,9)30-23/h11-12,17,25H,10,13H2,1-9H3/t17-,31?/m0/s1 |
| InChIKey | XMUZADOTNUENJQ-AUBGMPCYSA-N |
| XLogP | 3.48 |
| TPSA | 79.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|