C14H19ClFNO3S — CID 173470566
tert-butyl-[[(1S)-1-(2-chloro-3-fluorophenyl)-3-methoxy-3-oxopropyl]amino]-oxidosulfanium (PubChem CID 173470566) has the molecular formula C14H19ClFNO3S and a molecular weight of 335.83 g/mol. Its IUPAC name is tert-butyl-[[(1S)-1-(2-chloro-3-fluorophenyl)-3-methoxy-3-oxopropyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(1S)-1-(2-chloro-3-fluorophenyl)-3-methoxy-3-oxopropyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 173470566 |
| Molecular Formula | C14H19ClFNO3S |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | tert-butyl-[[(1S)-1-(2-chloro-3-fluorophenyl)-3-methoxy-3-oxopropyl]amino]-oxidosulfanium |
| SMILES | COC(=O)C[C@H](N[S+]([O-])C(C)(C)C)c1cccc(F)c1Cl |
| InChI | InChI=1S/C14H19ClFNO3S/c1-14(2,3)21(19)17-11(8-12(18)20-4)9-6-5-7-10(16)13(9)15/h5-7,11,17H,8H2,1-4H3/t11-,21?/m0/s1 |
| InChIKey | YVJIRJKUYKXGHE-QHIQZGGMSA-N |
| XLogP | 3.14 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|