C21H22BCl2F3O4 — CID 171814117
2-[4-[1-(3,4-dichlorophenyl)ethoxy]-3-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171814117) has the molecular formula C21H22BCl2F3O4 and a molecular weight of 477.12 g/mol. Its IUPAC name is 2-[4-[1-(3,4-dichlorophenyl)ethoxy]-3-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[1-(3,4-dichlorophenyl)ethoxy]-3-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171814117 |
| Molecular Formula | C21H22BCl2F3O4 |
| Molecular Weight | 477.12 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 2-[4-[1-(3,4-dichlorophenyl)ethoxy]-3-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(Oc1ccc(B2OC(C)(C)C(C)(C)O2)cc1OC(F)(F)F)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H22BCl2F3O4/c1-12(13-6-8-15(23)16(24)10-13)28-17-9-7-14(11-18(17)29-21(25,26)27)22-30-19(2,3)20(4,5)31-22/h6-12H,1-5H3 |
| InChIKey | YCLPUZBZHICCNE-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.12 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|