C14H18BClF3NO3 — CID 171191447
(S)-[3-chloro-4-(trifluoromethoxy)phenyl]-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine (PubChem CID 171191447) has the molecular formula C14H18BClF3NO3 and a molecular weight of 351.56 g/mol. Its IUPAC name is (S)-[3-chloro-4-(trifluoromethoxy)phenyl]-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine.
| Compound Name | (S)-[3-chloro-4-(trifluoromethoxy)phenyl]-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine |
|---|---|
| PubChem CID | 171191447 |
| Molecular Formula | C14H18BClF3NO3 |
| Molecular Weight | 351.56 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | (S)-[3-chloro-4-(trifluoromethoxy)phenyl]-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine |
| SMILES | CC1(C)OB([C@H](N)c2ccc(OC(F)(F)F)c(Cl)c2)OC1(C)C |
| InChI | InChI=1S/C14H18BClF3NO3/c1-12(2)13(3,4)23-15(22-12)11(20)8-5-6-10(9(16)7-8)21-14(17,18)19/h5-7,11H,20H2,1-4H3/t11-/m1/s1 |
| InChIKey | YJGDIVVZGILUAL-LLVKDONJSA-N |
| XLogP | 3.87 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|