C15H18BF6NO2 — CID 171190946
(R)-[3,5-bis(trifluoromethyl)phenyl]-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine (PubChem CID 171190946) has the molecular formula C15H18BF6NO2 and a molecular weight of 369.11 g/mol. Its IUPAC name is (R)-[3,5-bis(trifluoromethyl)phenyl]-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine.
| Compound Name | (R)-[3,5-bis(trifluoromethyl)phenyl]-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine |
|---|---|
| PubChem CID | 171190946 |
| Molecular Formula | C15H18BF6NO2 |
| Molecular Weight | 369.11 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | (R)-[3,5-bis(trifluoromethyl)phenyl]-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine |
| SMILES | CC1(C)OB([C@@H](N)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)OC1(C)C |
| InChI | InChI=1S/C15H18BF6NO2/c1-12(2)13(3,4)25-16(24-12)11(23)8-5-9(14(17,18)19)7-10(6-8)15(20,21)22/h5-7,11H,23H2,1-4H3/t11-/m0/s1 |
| InChIKey | ULBKUACKXQXDCM-NSHDSACASA-N |
| XLogP | 4.36 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.11 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|