C14H21BBrNO2 — CID 171191039
(R)-(3-bromo-4-methylphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine (PubChem CID 171191039) has the molecular formula C14H21BBrNO2 and a molecular weight of 326.04 g/mol. Its IUPAC name is (R)-(3-bromo-4-methylphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine.
| Compound Name | (R)-(3-bromo-4-methylphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine |
|---|---|
| PubChem CID | 171191039 |
| Molecular Formula | C14H21BBrNO2 |
| Molecular Weight | 326.04 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | (R)-(3-bromo-4-methylphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine |
| SMILES | Cc1ccc([C@H](N)B2OC(C)(C)C(C)(C)O2)cc1Br |
| InChI | InChI=1S/C14H21BBrNO2/c1-9-6-7-10(8-11(9)16)12(17)15-18-13(2,3)14(4,5)19-15/h6-8,12H,17H2,1-5H3/t12-/m0/s1 |
| InChIKey | VKURQHRWIQNZEV-LBPRGKRZSA-N |
| XLogP | 3.39 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.04 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|