C18H25BO3 — CID 86710763
4,4,5,5-tetramethyl-2-(4-prop-2-enyl-3,4-dihydro-2H-chromen-6-yl)-1,3,2-dioxaborolane (PubChem CID 86710763) has the molecular formula C18H25BO3 and a molecular weight of 300.21 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(4-prop-2-enyl-3,4-dihydro-2H-chromen-6-yl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(4-prop-2-enyl-3,4-dihydro-2H-chromen-6-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 86710763 |
| Molecular Formula | C18H25BO3 |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(4-prop-2-enyl-3,4-dihydro-2H-chromen-6-yl)-1,3,2-dioxaborolane |
| SMILES | C=CCC1CCOc2ccc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C18H25BO3/c1-6-7-13-10-11-20-16-9-8-14(12-15(13)16)19-21-17(2,3)18(4,5)22-19/h6,8-9,12-13H,1,7,10-11H2,2-5H3 |
| InChIKey | PZCBQBRRLMTJNF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|