About propyl 5-chlorosulfonyl-2,3-dihydro-1-benzofuran-2-carboxylate
propyl 5-chlorosulfonyl-2,3-dihydro-1-benzofuran-2-carboxylate (PubChem CID 65398834) has the molecular formula C12H13ClO5S
and a molecular weight of 304.75 g/mol. Its IUPAC name is propyl 5-chlorosulfonyl-2,3-dihydro-1-benzofuran-2-carboxylate.
Molecular Properties
| Compound Name | propyl 5-chlorosulfonyl-2,3-dihydro-1-benzofuran-2-carboxylate |
| PubChem CID | 65398834 |
| Molecular Formula | C12H13ClO5S |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | propyl 5-chlorosulfonyl-2,3-dihydro-1-benzofuran-2-carboxylate |
| SMILES | CCCOC(=O)C1Cc2cc(S(=O)(=O)Cl)ccc2O1 |
| InChI | InChI=1S/C12H13ClO5S/c1-2-5-17-12(14)11-7-8-6-9(19(13,15)16)3-4-10(8)18-11/h3-4,6,11H,2,5,7H2,1H3 |
| InChIKey | RUFRXWJUWFNENN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propyl 5-chlorosulfonyl-2,3-dihydro-1-benzofuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 5-chlorosulfonyl-2,3-dihydro-1-benzofuran-2-carboxylate?
The IUPAC name of propyl 5-chlorosulfonyl-2,3-dihydro-1-benzofuran-2-carboxylate (CID 65398834) is propyl 5-chlorosulfonyl-2,3-dihydro-1-benzofuran-2-carboxylate.
What is the SMILES notation for propyl 5-chlorosulfonyl-2,3-dihydro-1-benzofuran-2-carboxylate?
The canonical SMILES for propyl 5-chlorosulfonyl-2,3-dihydro-1-benzofuran-2-carboxylate is CCCOC(=O)C1Cc2cc(S(=O)(=O)Cl)ccc2O1.
What is the InChIKey of propyl 5-chlorosulfonyl-2,3-dihydro-1-benzofuran-2-carboxylate?
The InChIKey is RUFRXWJUWFNENN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClO5S/c1-2-5-17-12(14)11-7-8-6-9(19(13,15)16)3-4-10(8)18-11/h3-4,6,11H,2,5,7H2,1H3.
What are the key properties of propyl 5-chlorosulfonyl-2,3-dihydro-1-benzofuran-2-carboxylate?
propyl 5-chlorosulfonyl-2,3-dihydro-1-benzofuran-2-carboxylate has a molecular weight of 304.75 g/mol, XLogP of 1.87, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 5-chlorosulfonyl-2,3-dihydro-1-benzofuran-2-carboxylate is sourced from PubChem (CID 65398834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).