C18H18O6 — CID 22364456
ethyl (5-phenylmethoxy-2,3-dihydro-1,4-benzodioxin-7-yl) carbonate (PubChem CID 22364456) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is ethyl (5-phenylmethoxy-2,3-dihydro-1,4-benzodioxin-7-yl) carbonate.
| Compound Name | ethyl (5-phenylmethoxy-2,3-dihydro-1,4-benzodioxin-7-yl) carbonate |
|---|---|
| PubChem CID | 22364456 |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | ethyl (5-phenylmethoxy-2,3-dihydro-1,4-benzodioxin-7-yl) carbonate |
| SMILES | CCOC(=O)Oc1cc2c(c(OCc3ccccc3)c1)OCCO2 |
| InChI | InChI=1S/C18H18O6/c1-2-20-18(19)24-14-10-15-17(22-9-8-21-15)16(11-14)23-12-13-6-4-3-5-7-13/h3-7,10-11H,2,8-9,12H2,1H3 |
| InChIKey | KUKOWRJKCHNJBS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|