C21H25BrO3 — CID 22924630
7-[2-(bromomethyl)-3-methylbutyl]-5-phenylmethoxy-2,3-dihydro-1,4-benzodioxine (PubChem CID 22924630) has the molecular formula C21H25BrO3 and a molecular weight of 405.33 g/mol. Its IUPAC name is 7-[2-(bromomethyl)-3-methylbutyl]-5-phenylmethoxy-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 7-[2-(bromomethyl)-3-methylbutyl]-5-phenylmethoxy-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 22924630 |
| Molecular Formula | C21H25BrO3 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 7-[2-(bromomethyl)-3-methylbutyl]-5-phenylmethoxy-2,3-dihydro-1,4-benzodioxine |
| SMILES | CC(C)C(CBr)Cc1cc2c(c(OCc3ccccc3)c1)OCCO2 |
| InChI | InChI=1S/C21H25BrO3/c1-15(2)18(13-22)10-17-11-19-21(24-9-8-23-19)20(12-17)25-14-16-6-4-3-5-7-16/h3-7,11-12,15,18H,8-10,13-14H2,1-2H3 |
| InChIKey | DSOUTCCGRFMWMH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|