C27H25NO7 — CID 139985414
6-methoxy-3-(6-methoxy-1,3-benzodioxol-5-yl)-4-methoxyimino-7-phenylmethoxy-2,3-dihydronaphthalen-1-one (PubChem CID 139985414) has the molecular formula C27H25NO7 and a molecular weight of 475.50 g/mol. Its IUPAC name is 6-methoxy-3-(6-methoxy-1,3-benzodioxol-5-yl)-4-methoxyimino-7-phenylmethoxy-2,3-dihydronaphthalen-1-one.
| Compound Name | 6-methoxy-3-(6-methoxy-1,3-benzodioxol-5-yl)-4-methoxyimino-7-phenylmethoxy-2,3-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 139985414 |
| Molecular Formula | C27H25NO7 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 6-methoxy-3-(6-methoxy-1,3-benzodioxol-5-yl)-4-methoxyimino-7-phenylmethoxy-2,3-dihydronaphthalen-1-one |
| SMILES | CON=C1c2cc(OC)c(OCc3ccccc3)cc2C(=O)CC1c1cc2c(cc1OC)OCO2 |
| InChI | InChI=1S/C27H25NO7/c1-30-22-13-26-25(34-15-35-26)11-18(22)19-9-21(29)17-10-24(33-14-16-7-5-4-6-8-16)23(31-2)12-20(17)27(19)28-32-3/h4-8,10-13,19H,9,14-15H2,1-3H3 |
| InChIKey | VPKGJGHXDFDHGF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 84.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|