C22H19N3O4 — CID 11058208
5-(azidomethyl)-6-(3-methoxy-4-phenylmethoxyphenyl)-1,3-benzodioxole (PubChem CID 11058208) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is 5-(azidomethyl)-6-(3-methoxy-4-phenylmethoxyphenyl)-1,3-benzodioxole.
| Compound Name | 5-(azidomethyl)-6-(3-methoxy-4-phenylmethoxyphenyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 11058208 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 5-(azidomethyl)-6-(3-methoxy-4-phenylmethoxyphenyl)-1,3-benzodioxole |
| SMILES | COc1cc(-c2cc3c(cc2CN=[N+]=[N-])OCO3)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H19N3O4/c1-26-20-9-16(7-8-19(20)27-13-15-5-3-2-4-6-15)18-11-22-21(28-14-29-22)10-17(18)12-24-25-23/h2-11H,12-14H2,1H3 |
| InChIKey | DTQNUQJXEPIMLL-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|