C31H26N2O7 — CID 125325442
(1S,2R,6R,7S,8R,12S)-10-(1,3-benzodioxol-5-yl)-5-(3-methoxy-4-phenylmethoxyphenyl)-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione (PubChem CID 125325442) has the molecular formula C31H26N2O7 and a molecular weight of 538.56 g/mol. Its IUPAC name is (1S,2R,6R,7S,8R,12S)-10-(1,3-benzodioxol-5-yl)-5-(3-methoxy-4-phenylmethoxyphenyl)-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione.
| Compound Name | (1S,2R,6R,7S,8R,12S)-10-(1,3-benzodioxol-5-yl)-5-(3-methoxy-4-phenylmethoxyphenyl)-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
|---|---|
| PubChem CID | 125325442 |
| Molecular Formula | C31H26N2O7 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | (1S,2R,6R,7S,8R,12S)-10-(1,3-benzodioxol-5-yl)-5-(3-methoxy-4-phenylmethoxyphenyl)-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
| SMILES | COc1cc(C2=NO[C@@H]3[C@H]4C[C@H]([C@H]5C(=O)N(c6ccc7c(c6)OCO7)C(=O)[C@@H]45)[C@H]23)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C31H26N2O7/c1-36-23-11-17(7-9-21(23)37-14-16-5-3-2-4-6-16)28-27-19-13-20(29(27)40-32-28)26-25(19)30(34)33(31(26)35)18-8-10-22-24(12-18)39-15-38-22/h2-12,19-20,25-27,29H,13-15H2,1H3/t19-,20+,25-,26+,27-,29-/m1/s1 |
| InChIKey | UPELNJDSSGZXAB-ZKLROTKASA-N |
| XLogP | 4.18 |
| TPSA | 95.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|