C20H20N2O7 — CID 18556041
2-[(1S,2R,6R,7S,8R,12S)-5-(3,4-dimethoxyphenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]acetic acid (PubChem CID 18556041) has the molecular formula C20H20N2O7 and a molecular weight of 400.39 g/mol. Its IUPAC name is 2-[(1S,2R,6R,7S,8R,12S)-5-(3,4-dimethoxyphenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]acetic acid.
| Compound Name | 2-[(1S,2R,6R,7S,8R,12S)-5-(3,4-dimethoxyphenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]acetic acid |
|---|---|
| PubChem CID | 18556041 |
| Molecular Formula | C20H20N2O7 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 2-[(1S,2R,6R,7S,8R,12S)-5-(3,4-dimethoxyphenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]acetic acid |
| SMILES | COc1ccc(C2=NO[C@@H]3[C@H]4C[C@H]([C@H]5C(=O)N(CC(=O)O)C(=O)[C@@H]45)[C@H]23)cc1OC |
| InChI | InChI=1S/C20H20N2O7/c1-27-11-4-3-8(5-12(11)28-2)17-16-9-6-10(18(16)29-21-17)15-14(9)19(25)22(20(15)26)7-13(23)24/h3-5,9-10,14-16,18H,6-7H2,1-2H3,(H,23,24)/t9-,10+,14-,15+,16-,18-/m1/s1 |
| InChIKey | KBCAYHGOFXNCIX-OIUHXKLASA-N |
| XLogP | 0.76 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|