C22H20O5 — CID 10948495
[6-(3-methoxy-4-phenylmethoxyphenyl)-1,3-benzodioxol-5-yl]methanol (PubChem CID 10948495) has the molecular formula C22H20O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is [6-(3-methoxy-4-phenylmethoxyphenyl)-1,3-benzodioxol-5-yl]methanol.
| Compound Name | [6-(3-methoxy-4-phenylmethoxyphenyl)-1,3-benzodioxol-5-yl]methanol |
|---|---|
| PubChem CID | 10948495 |
| Molecular Formula | C22H20O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | [6-(3-methoxy-4-phenylmethoxyphenyl)-1,3-benzodioxol-5-yl]methanol |
| SMILES | COc1cc(-c2cc3c(cc2CO)OCO3)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H20O5/c1-24-20-9-16(7-8-19(20)25-13-15-5-3-2-4-6-15)18-11-22-21(26-14-27-22)10-17(18)12-23/h2-11,23H,12-14H2,1H3 |
| InChIKey | IBXOEVXSNWBMMH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |