C19H18O4 — CID 102167345
6,7-dimethoxy-4-phenyl-3,4-dihydronaphthalene-2-carboxylic acid (PubChem CID 102167345) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is 6,7-dimethoxy-4-phenyl-3,4-dihydronaphthalene-2-carboxylic acid.
| Compound Name | 6,7-dimethoxy-4-phenyl-3,4-dihydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 102167345 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 6,7-dimethoxy-4-phenyl-3,4-dihydronaphthalene-2-carboxylic acid |
| SMILES | COc1cc2c(cc1OC)C(c1ccccc1)CC(C(=O)O)=C2 |
| InChI | InChI=1S/C19H18O4/c1-22-17-10-13-8-14(19(20)21)9-15(12-6-4-3-5-7-12)16(13)11-18(17)23-2/h3-8,10-11,15H,9H2,1-2H3,(H,20,21) |
| InChIKey | JFPUGGXZSPEMMA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |