C18H20O3 — CID 158553914
(3S)-5-methoxy-16-methyltricyclo[10.4.0.04,9]hexadeca-1(16),4(9),5,7,12,14-hexaene-2,3-diol (PubChem CID 158553914) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is (3S)-5-methoxy-16-methyltricyclo[10.4.0.04,9]hexadeca-1(16),4(9),5,7,12,14-hexaene-2,3-diol.
| Compound Name | (3S)-5-methoxy-16-methyltricyclo[10.4.0.04,9]hexadeca-1(16),4(9),5,7,12,14-hexaene-2,3-diol |
|---|---|
| PubChem CID | 158553914 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (3S)-5-methoxy-16-methyltricyclo[10.4.0.04,9]hexadeca-1(16),4(9),5,7,12,14-hexaene-2,3-diol |
| SMILES | COc1cccc2c1[C@H](O)C(O)c1c(C)cccc1CC2 |
| InChI | InChI=1S/C18H20O3/c1-11-5-3-6-12-9-10-13-7-4-8-14(21-2)16(13)18(20)17(19)15(11)12/h3-8,17-20H,9-10H2,1-2H3/t17?,18-/m0/s1 |
| InChIKey | MAZHZZXLRJTXJS-ZVAWYAOSSA-N |
| XLogP | 2.87 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |